About 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide
5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide (PubChem CID 114281626) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide.
Molecular Properties
| Compound Name | 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide |
| PubChem CID | 114281626 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide |
| SMILES | CN1CCC(C)(CNCCCCC(N)=O)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-13(6-9-16(2)10-7-13)11-15-8-4-3-5-12(14)17/h15H,3-11H2,1-2H3,(H2,14,17) |
| InChIKey | QVKRHNCQECCHKY-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide?
The IUPAC name of 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide (CID 114281626) is 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide.
What is the SMILES notation for 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide?
The canonical SMILES for 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide is CN1CCC(C)(CNCCCCC(N)=O)CC1.
What is the InChIKey of 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide?
The InChIKey is QVKRHNCQECCHKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O/c1-13(6-9-16(2)10-7-13)11-15-8-4-3-5-12(14)17/h15H,3-11H2,1-2H3,(H2,14,17).
What are the key properties of 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide?
5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide has a molecular weight of 241.38 g/mol, XLogP of 0.96, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,4-dimethylpiperidin-4-yl)methylamino]pentanamide is sourced from PubChem (CID 114281626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).