C16H34N4O — CID 107164198
6-[(1,4-dimethylpiperidin-4-yl)methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 107164198) has the molecular formula C16H34N4O and a molecular weight of 298.47 g/mol. Its IUPAC name is 6-[(1,4-dimethylpiperidin-4-yl)methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-[(1,4-dimethylpiperidin-4-yl)methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 107164198 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 6-[(1,4-dimethylpiperidin-4-yl)methylamino]-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CN1CCC(C)(CNCCCCC(C)(C)C(N)=NO)CC1 |
| InChI | InChI=1S/C16H34N4O/c1-15(2,14(17)19-21)7-5-6-10-18-13-16(3)8-11-20(4)12-9-16/h18,21H,5-13H2,1-4H3,(H2,17,19) |
| InChIKey | IPNHAVBRFWNAIN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|