C13H17F4N3 — CID 103989894
N-[(1,4-dimethylpiperidin-4-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 103989894) has the molecular formula C13H17F4N3 and a molecular weight of 291.29 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 103989894 |
| Molecular Formula | C13H17F4N3 |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CN1CCC(C)(CNc2c(F)c(F)nc(F)c2F)CC1 |
| InChI | InChI=1S/C13H17F4N3/c1-13(3-5-20(2)6-4-13)7-18-10-8(14)11(16)19-12(17)9(10)15/h3-7H2,1-2H3,(H,18,19) |
| InChIKey | SDZGKFRCWRYXHB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|