C10H22N2 — CID 14979285
2-(4,4-dimethylpiperidin-1-yl)-N-methylethanamine (PubChem CID 14979285) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperidin-1-yl)-N-methylethanamine.
| Compound Name | 2-(4,4-dimethylpiperidin-1-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 14979285 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2-(4,4-dimethylpiperidin-1-yl)-N-methylethanamine |
| SMILES | CNCCN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C10H22N2/c1-10(2)4-7-12(8-5-10)9-6-11-3/h11H,4-9H2,1-3H3 |
| InChIKey | LOZRTBODNYQGQX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |