N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen

C7H18N2O — CID 143640277

IUPACN-methyl-2-morpholin-4-ylethanamine;molecular hydrogen
SMILESCNCCN1CCOCC1.[H][H]
InChIInChI=1S/C7H16N2O.H2/c1-8-2-3-9-4-6-10-7-5-9;/h8H,2-7H2,1H3;1H
InChIKeySRCHLCKYMZVWPR-UHFFFAOYSA-N
MW146.23 g/mol
LogP-0.22
Rot. Bonds3

About N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen

N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen (PubChem CID 143640277) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen.

Molecular Properties

Compound NameN-methyl-2-morpholin-4-ylethanamine;molecular hydrogen
PubChem CID143640277
Molecular FormulaC7H18N2O
Molecular Weight146.23 g/mol
Exact Mass146.14
IUPAC NameN-methyl-2-morpholin-4-ylethanamine;molecular hydrogen
SMILESCNCCN1CCOCC1.[H][H]
InChIInChI=1S/C7H16N2O.H2/c1-8-2-3-9-4-6-10-7-5-9;/h8H,2-7H2,1H3;1H
InChIKeySRCHLCKYMZVWPR-UHFFFAOYSA-N
XLogP-0.22
TPSA24.50 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.23
LogP ≤ 5-0.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen?
The IUPAC name of N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen (CID 143640277) is N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen.
What is the SMILES notation for N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen?
The canonical SMILES for N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen is CNCCN1CCOCC1.[H][H].
What is the InChIKey of N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen?
The InChIKey is SRCHLCKYMZVWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O.H2/c1-8-2-3-9-4-6-10-7-5-9;/h8H,2-7H2,1H3;1H.
What are the key properties of N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen?
N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen has a molecular weight of 146.23 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-morpholin-4-ylethanamine;molecular hydrogen is sourced from PubChem (CID 143640277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).