C15H33N — CID 142891140
4,4-dimethyl-1-(4-methylpentyl)piperidine;ethane (PubChem CID 142891140) has the molecular formula C15H33N and a molecular weight of 227.44 g/mol. Its IUPAC name is 4,4-dimethyl-1-(4-methylpentyl)piperidine;ethane.
| Compound Name | 4,4-dimethyl-1-(4-methylpentyl)piperidine;ethane |
|---|---|
| PubChem CID | 142891140 |
| Molecular Formula | C15H33N |
| Molecular Weight | 227.44 g/mol |
| Exact Mass | 227.26 |
| IUPAC Name | 4,4-dimethyl-1-(4-methylpentyl)piperidine;ethane |
| SMILES | CC.CC(C)CCCN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H27N.C2H6/c1-12(2)6-5-9-14-10-7-13(3,4)8-11-14;1-2/h12H,5-11H2,1-4H3;1-2H3 |
| InChIKey | LJWVGKDAHMOLBC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |