C8H19N — CID 158632756
methane;1,3,3-trimethylpyrrolidine (PubChem CID 158632756) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is methane;1,3,3-trimethylpyrrolidine.
| Compound Name | methane;1,3,3-trimethylpyrrolidine |
|---|---|
| PubChem CID | 158632756 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | methane;1,3,3-trimethylpyrrolidine |
| SMILES | C.CN1CCC(C)(C)C1 |
| InChI | InChI=1S/C7H15N.CH4/c1-7(2)4-5-8(3)6-7;/h4-6H2,1-3H3;1H4 |
| InChIKey | HYMINWGYHMEKRT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |