C6H13NS — CID 143872157
3,3-dimethyl-1-sulfanylpyrrolidine (PubChem CID 143872157) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is 3,3-dimethyl-1-sulfanylpyrrolidine.
| Compound Name | 3,3-dimethyl-1-sulfanylpyrrolidine |
|---|---|
| PubChem CID | 143872157 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | 3,3-dimethyl-1-sulfanylpyrrolidine |
| SMILES | CC1(C)CCN(S)C1 |
| InChI | InChI=1S/C6H13NS/c1-6(2)3-4-7(8)5-6/h8H,3-5H2,1-2H3 |
| InChIKey | YDKSCDVZHMWOFW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|