C10H20N2S — CID 145242216
(7aS)-1,3a,7a-trimethyl-6-sulfanyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 145242216) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is (7aS)-1,3a,7a-trimethyl-6-sulfanyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | (7aS)-1,3a,7a-trimethyl-6-sulfanyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 145242216 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (7aS)-1,3a,7a-trimethyl-6-sulfanyl-3,4,5,7-tetrahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CCC2(C)CCN(S)C[C@@]12C |
| InChI | InChI=1S/C10H20N2S/c1-9-4-6-11(3)10(9,2)8-12(13)7-5-9/h13H,4-8H2,1-3H3/t9?,10-/m1/s1 |
| InChIKey | MDMBPYBDMXBONT-QVDQXJPCSA-N |
| XLogP | 1.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|