C8H16N2S — CID 123827832
6-methyl-1-sulfanyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 123827832) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is 6-methyl-1-sulfanyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | 6-methyl-1-sulfanyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 123827832 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 6-methyl-1-sulfanyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CCC2CCN(S)C2C1 |
| InChI | InChI=1S/C8H16N2S/c1-9-4-2-7-3-5-10(11)8(7)6-9/h7-8,11H,2-6H2,1H3 |
| InChIKey | HBRVGYZUICYKFP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|