C7H14N2S2 — CID 169000386
2,7-bis(sulfanyl)-2,7-diazaspiro[3.5]nonane (PubChem CID 169000386) has the molecular formula C7H14N2S2 and a molecular weight of 190.34 g/mol. Its IUPAC name is 2,7-bis(sulfanyl)-2,7-diazaspiro[3.5]nonane.
| Compound Name | 2,7-bis(sulfanyl)-2,7-diazaspiro[3.5]nonane |
|---|---|
| PubChem CID | 169000386 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 2,7-bis(sulfanyl)-2,7-diazaspiro[3.5]nonane |
| SMILES | SN1CCC2(CC1)CN(S)C2 |
| InChI | InChI=1S/C7H14N2S2/c10-8-3-1-7(2-4-8)5-9(11)6-7/h10-11H,1-6H2 |
| InChIKey | CMHNNIUKGLUSEF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|