About 2-sulfanyl-2,7-diazaspiro[3.4]octane
2-sulfanyl-2,7-diazaspiro[3.4]octane (PubChem CID 146741021) has the molecular formula C6H12N2S
and a molecular weight of 144.24 g/mol. Its IUPAC name is 2-sulfanyl-2,7-diazaspiro[3.4]octane.
Molecular Properties
| Compound Name | 2-sulfanyl-2,7-diazaspiro[3.4]octane |
| PubChem CID | 146741021 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-sulfanyl-2,7-diazaspiro[3.4]octane |
| SMILES | SN1CC2(CCNC2)C1 |
| InChI | InChI=1S/C6H12N2S/c9-8-4-6(5-8)1-2-7-3-6/h7,9H,1-5H2 |
| InChIKey | RKUXJSGFBZHYMW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-2,7-diazaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-2,7-diazaspiro[3.4]octane?
The IUPAC name of 2-sulfanyl-2,7-diazaspiro[3.4]octane (CID 146741021) is 2-sulfanyl-2,7-diazaspiro[3.4]octane.
What is the SMILES notation for 2-sulfanyl-2,7-diazaspiro[3.4]octane?
The canonical SMILES for 2-sulfanyl-2,7-diazaspiro[3.4]octane is SN1CC2(CCNC2)C1.
What is the InChIKey of 2-sulfanyl-2,7-diazaspiro[3.4]octane?
The InChIKey is RKUXJSGFBZHYMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S/c9-8-4-6(5-8)1-2-7-3-6/h7,9H,1-5H2.
What are the key properties of 2-sulfanyl-2,7-diazaspiro[3.4]octane?
2-sulfanyl-2,7-diazaspiro[3.4]octane has a molecular weight of 144.24 g/mol, XLogP of 0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-2,7-diazaspiro[3.4]octane is sourced from PubChem (CID 146741021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).