C6H12N2S — CID 146741021
2-sulfanyl-2,7-diazaspiro[3.4]octane (PubChem CID 146741021) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is 2-sulfanyl-2,7-diazaspiro[3.4]octane.
| Compound Name | 2-sulfanyl-2,7-diazaspiro[3.4]octane |
|---|---|
| PubChem CID | 146741021 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 2-sulfanyl-2,7-diazaspiro[3.4]octane |
| SMILES | SN1CC2(CCNC2)C1 |
| InChI | InChI=1S/C6H12N2S/c9-8-4-6(5-8)1-2-7-3-6/h7,9H,1-5H2 |
| InChIKey | RKUXJSGFBZHYMW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|