C6H12N2 — CID 148820818
6-methyl-1,6-diazaspiro[2.4]heptane (PubChem CID 148820818) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 6-methyl-1,6-diazaspiro[2.4]heptane.
| Compound Name | 6-methyl-1,6-diazaspiro[2.4]heptane |
|---|---|
| PubChem CID | 148820818 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 6-methyl-1,6-diazaspiro[2.4]heptane |
| SMILES | CN1CCC2(CN2)C1 |
| InChI | InChI=1S/C6H12N2/c1-8-3-2-6(5-8)4-7-6/h7H,2-5H2,1H3 |
| InChIKey | ORTATYAYTAYMRN-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 25.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|