C7H13FN2 — CID 163443582
(3S,4S)-3-(aziridin-1-yl)-4-(fluoromethyl)pyrrolidine (PubChem CID 163443582) has the molecular formula C7H13FN2 and a molecular weight of 144.19 g/mol. Its IUPAC name is (3S,4S)-3-(aziridin-1-yl)-4-(fluoromethyl)pyrrolidine.
| Compound Name | (3S,4S)-3-(aziridin-1-yl)-4-(fluoromethyl)pyrrolidine |
|---|---|
| PubChem CID | 163443582 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | (3S,4S)-3-(aziridin-1-yl)-4-(fluoromethyl)pyrrolidine |
| SMILES | FC[C@H]1CNC[C@H]1N1CC1 |
| InChI | InChI=1S/C7H13FN2/c8-3-6-4-9-5-7(6)10-1-2-10/h6-7,9H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | BAPPQEFVXARDML-NKWVEPMBSA-N |
| XLogP | -0.14 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|