C5H11FN2 — CID 10953477
(3S,4S)-4-(fluoromethyl)pyrrolidin-3-amine (PubChem CID 10953477) has the molecular formula C5H11FN2 and a molecular weight of 118.16 g/mol. Its IUPAC name is (3S,4S)-4-(fluoromethyl)pyrrolidin-3-amine.
| Compound Name | (3S,4S)-4-(fluoromethyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 10953477 |
| Molecular Formula | C5H11FN2 |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | (3S,4S)-4-(fluoromethyl)pyrrolidin-3-amine |
| SMILES | N[C@@H]1CNC[C@@H]1CF |
| InChI | InChI=1S/C5H11FN2/c6-1-4-2-8-3-5(4)7/h4-5,8H,1-3,7H2/t4-,5+/m0/s1 |
| InChIKey | GZWCITMIQSNGLN-CRCLSJGQSA-N |
| XLogP | -0.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |