C10H19NO2 — CID 134365428
2-(1,3-dimethylazepan-3-yl)acetic acid (PubChem CID 134365428) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(1,3-dimethylazepan-3-yl)acetic acid.
| Compound Name | 2-(1,3-dimethylazepan-3-yl)acetic acid |
|---|---|
| PubChem CID | 134365428 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-(1,3-dimethylazepan-3-yl)acetic acid |
| SMILES | CN1CCCCC(C)(CC(=O)O)C1 |
| InChI | InChI=1S/C10H19NO2/c1-10(7-9(12)13)5-3-4-6-11(2)8-10/h3-8H2,1-2H3,(H,12,13) |
| InChIKey | OJKLFBCITJCYQX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |