C7H16N2S — CID 142150706
N-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine (PubChem CID 142150706) has the molecular formula C7H16N2S and a molecular weight of 160.29 g/mol. Its IUPAC name is N-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine.
| Compound Name | N-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 142150706 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N-(1,4-dimethylpiperidin-4-yl)thiohydroxylamine |
| SMILES | CN1CCC(C)(NS)CC1 |
| InChI | InChI=1S/C7H16N2S/c1-7(8-10)3-5-9(2)6-4-7/h8,10H,3-6H2,1-2H3 |
| InChIKey | ZODCOPFBAIEEMG-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|