C12H27N — CID 142456453
1,4-dimethyl-4-propan-2-ylpiperidine;ethane (PubChem CID 142456453) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is 1,4-dimethyl-4-propan-2-ylpiperidine;ethane.
| Compound Name | 1,4-dimethyl-4-propan-2-ylpiperidine;ethane |
|---|---|
| PubChem CID | 142456453 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 1,4-dimethyl-4-propan-2-ylpiperidine;ethane |
| SMILES | CC.CC(C)C1(C)CCN(C)CC1 |
| InChI | InChI=1S/C10H21N.C2H6/c1-9(2)10(3)5-7-11(4)8-6-10;1-2/h9H,5-8H2,1-4H3;1-2H3 |
| InChIKey | WFRFLOKLHDLAOT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |