C7H14Zn — CID 174960258
1,1-dimethylcyclopentane;zinc (PubChem CID 174960258) has the molecular formula C7H14Zn and a molecular weight of 163.58 g/mol. Its IUPAC name is 1,1-dimethylcyclopentane;zinc.
| Compound Name | 1,1-dimethylcyclopentane;zinc |
|---|---|
| PubChem CID | 174960258 |
| Molecular Formula | C7H14Zn |
| Molecular Weight | 163.58 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 1,1-dimethylcyclopentane;zinc |
| SMILES | CC1(C)CCCC1.[Zn] |
| InChI | InChI=1S/C7H14.Zn/c1-7(2)5-3-4-6-7;/h3-6H2,1-2H3; |
| InChIKey | PDLXXFYDJSNFRB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.58 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|