C12H32 — CID 160770296
1,1-dimethylcyclohexane;methane (PubChem CID 160770296) has the molecular formula C12H32 and a molecular weight of 176.39 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;methane.
| Compound Name | 1,1-dimethylcyclohexane;methane |
|---|---|
| PubChem CID | 160770296 |
| Molecular Formula | C12H32 |
| Molecular Weight | 176.39 g/mol |
| Exact Mass | 176.25 |
| IUPAC Name | 1,1-dimethylcyclohexane;methane |
| SMILES | C.C.C.C.CC1(C)CCCCC1 |
| InChI | InChI=1S/C8H16.4CH4/c1-8(2)6-4-3-5-7-8;;;;/h3-7H2,1-2H3;4*1H4 |
| InChIKey | RZFNUBIKPLAQJN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.39 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |