C23H40 — CID 90776406
5,7a-dimethyl-1-(7-methyloctan-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 90776406) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is 5,7a-dimethyl-1-(7-methyloctan-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | 5,7a-dimethyl-1-(7-methyloctan-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 90776406 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | 5,7a-dimethyl-1-(7-methyloctan-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=CC=C1C(C)CCC2(C)C1CCC2C(CC)CCCC(C)C |
| InChI | InChI=1S/C23H40/c1-7-10-20-18(5)15-16-23(6)21(13-14-22(20)23)19(8-2)12-9-11-17(3)4/h7,10,17-19,21-22H,1,8-9,11-16H2,2-6H3 |
| InChIKey | NEFCTXJLWIDTBT-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |