C23H38 — CID 123643903
7a-methyl-1-(7-methylnon-1-en-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 123643903) has the molecular formula C23H38 and a molecular weight of 314.56 g/mol. Its IUPAC name is 7a-methyl-1-(7-methylnon-1-en-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | 7a-methyl-1-(7-methylnon-1-en-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 123643903 |
| Molecular Formula | C23H38 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | 7a-methyl-1-(7-methylnon-1-en-3-yl)-4-prop-2-enylidene-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=CC=C1CCCC2(C)C1CCC2C(C=C)CCCC(C)CC |
| InChI | InChI=1S/C23H38/c1-6-11-20-14-10-17-23(5)21(15-16-22(20)23)19(8-3)13-9-12-18(4)7-2/h6,8,11,18-19,21-22H,1,3,7,9-10,12-17H2,2,4-5H3 |
| InChIKey | OKHMPGDZZBBPML-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|