C29H48 — CID 143831302
(4E)-7a-ethyl-1-(6-methylheptan-2-yl)-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 143831302) has the molecular formula C29H48 and a molecular weight of 396.70 g/mol. Its IUPAC name is (4E)-7a-ethyl-1-(6-methylheptan-2-yl)-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | (4E)-7a-ethyl-1-(6-methylheptan-2-yl)-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 143831302 |
| Molecular Formula | C29H48 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | (4E)-7a-ethyl-1-(6-methylheptan-2-yl)-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CC/C(=C/C=C2\CCCC3(CC)C2CCC3C(C)CCCC(C)C)CC1C |
| InChI | InChI=1S/C29H48/c1-7-29-19-9-12-26(16-15-25-14-13-22(4)24(6)20-25)28(29)18-17-27(29)23(5)11-8-10-21(2)3/h15-16,21,23-24,27-28H,4,7-14,17-20H2,1-3,5-6H3/b25-15-,26-16+ |
| InChIKey | QVTWENSEQXGVPX-WFOJNGAISA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|