C27H42 — CID 143925025
(3Z,7E)-3a-methyl-3-(5-methylhexylidene)-7-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-1,2,4,5,6,7a-hexahydroindene (PubChem CID 143925025) has the molecular formula C27H42 and a molecular weight of 366.63 g/mol. Its IUPAC name is (3Z,7E)-3a-methyl-3-(5-methylhexylidene)-7-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-1,2,4,5,6,7a-hexahydroindene.
| Compound Name | (3Z,7E)-3a-methyl-3-(5-methylhexylidene)-7-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-1,2,4,5,6,7a-hexahydroindene |
|---|---|
| PubChem CID | 143925025 |
| Molecular Formula | C27H42 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.33 |
| IUPAC Name | (3Z,7E)-3a-methyl-3-(5-methylhexylidene)-7-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-1,2,4,5,6,7a-hexahydroindene |
| SMILES | C=C1CC/C(=C/C=C2\CCCC3(C)/C(=C\CCCC(C)C)CCC23)CC1C |
| InChI | InChI=1S/C27H42/c1-20(2)9-6-7-11-25-16-17-26-24(10-8-18-27(25,26)5)15-14-23-13-12-21(3)22(4)19-23/h11,14-15,20,22,26H,3,6-10,12-13,16-19H2,1-2,4-5H3/b23-14-,24-15+,25-11- |
| InChIKey | BBICHBRBJJJCHD-FLYAFKNOSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|