C30H48 — CID 91264175
5-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-8a-methyl-1-(6-methylhept-3-en-2-yl)-1,2,3,4,4a,6,7,8-octahydronaphthalene (PubChem CID 91264175) has the molecular formula C30H48 and a molecular weight of 408.71 g/mol. Its IUPAC name is 5-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-8a-methyl-1-(6-methylhept-3-en-2-yl)-1,2,3,4,4a,6,7,8-octahydronaphthalene.
| Compound Name | 5-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-8a-methyl-1-(6-methylhept-3-en-2-yl)-1,2,3,4,4a,6,7,8-octahydronaphthalene |
|---|---|
| PubChem CID | 91264175 |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 g/mol |
| Exact Mass | 408.38 |
| IUPAC Name | 5-[2-(3,5-dimethyl-4-methylidenecyclohexylidene)ethylidene]-8a-methyl-1-(6-methylhept-3-en-2-yl)-1,2,3,4,4a,6,7,8-octahydronaphthalene |
| SMILES | C=C1C(C)CC(=CC=C2CCCC3(C)C2CCCC3C(C)C=CCC(C)C)CC1C |
| InChI | InChI=1S/C30H48/c1-21(2)11-8-12-22(3)28-14-9-15-29-27(13-10-18-30(28,29)7)17-16-26-19-23(4)25(6)24(5)20-26/h8,12,16-17,21-24,28-29H,6,9-11,13-15,18-20H2,1-5,7H3 |
| InChIKey | ZZYAEYMQHRMCFN-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.71 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|