C31H54 — CID 143651881
ethane;(4E)-1-[(E)-hept-3-en-2-yl]-7a-methyl-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene (PubChem CID 143651881) has the molecular formula C31H54 and a molecular weight of 426.77 g/mol. Its IUPAC name is ethane;(4E)-1-[(E)-hept-3-en-2-yl]-7a-methyl-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene.
| Compound Name | ethane;(4E)-1-[(E)-hept-3-en-2-yl]-7a-methyl-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
|---|---|
| PubChem CID | 143651881 |
| Molecular Formula | C31H54 |
| Molecular Weight | 426.77 g/mol |
| Exact Mass | 426.42 |
| IUPAC Name | ethane;(4E)-1-[(E)-hept-3-en-2-yl]-7a-methyl-4-[(2Z)-2-(3-methyl-4-methylidenecyclohexylidene)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-indene |
| SMILES | C=C1CC/C(=C/C=C2\CCCC3(C)C2CCC3C(C)/C=C/CCC)CC1C.CC.CC |
| InChI | InChI=1S/C27H42.2C2H6/c1-6-7-8-10-21(3)25-16-17-26-24(11-9-18-27(25,26)5)15-14-23-13-12-20(2)22(4)19-23;2*1-2/h8,10,14-15,21-22,25-26H,2,6-7,9,11-13,16-19H2,1,3-5H3;2*1-2H3/b10-8+,23-14-,24-15+;; |
| InChIKey | PRWXMZRRLKUNQA-RTCKNYIZSA-N |
| XLogP | 10.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.77 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|