C31H50O — CID 142089611
(1R,5Z)-5-[(2E)-2-[(7aR)-1-[(Z,2S)-6-ethyldec-5-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol (PubChem CID 142089611) has the molecular formula C31H50O and a molecular weight of 438.74 g/mol. Its IUPAC name is (1R,5Z)-5-[(2E)-2-[(7aR)-1-[(Z,2S)-6-ethyldec-5-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol.
| Compound Name | (1R,5Z)-5-[(2E)-2-[(7aR)-1-[(Z,2S)-6-ethyldec-5-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 142089611 |
| Molecular Formula | C31H50O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.39 |
| IUPAC Name | (1R,5Z)-5-[(2E)-2-[(7aR)-1-[(Z,2S)-6-ethyldec-5-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC/C(=C/C=C2\CCC[C@@]3(C)C2CCC3[C@@H](C)CC/C=C(/CC)CCCC)C[C@H]1O |
| InChI | InChI=1S/C31H50O/c1-6-8-12-25(7-2)13-9-11-23(3)28-19-20-29-27(14-10-21-31(28,29)5)18-17-26-16-15-24(4)30(32)22-26/h13,17-18,23,28-30,32H,4,6-12,14-16,19-22H2,1-3,5H3/b25-13-,26-17-,27-18+/t23-,28?,29?,30+,31+/m0/s1 |
| InChIKey | WBWNHMMIOIKWHU-IEGNMBSOSA-N |
| XLogP | 9.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|