C24H37NO2 — CID 143056420
trans-(1R,3R,5Z)-5-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[(2S)-pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidene-3-nitrosocyclohexan-1-ol (PubChem CID 143056420) has the molecular formula C24H37NO2 and a molecular weight of 371.57 g/mol. Its IUPAC name is trans-(1R,3R,5Z)-5-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[(2S)-pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidene-3-nitrosocyclohexan-1-ol.
| Compound Name | trans-(1R,3R,5Z)-5-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[(2S)-pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidene-3-nitrosocyclohexan-1-ol |
|---|---|
| PubChem CID | 143056420 |
| Molecular Formula | C24H37NO2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | trans-(1R,3R,5Z)-5-[(2E)-2-[(3aS,7aR)-7a-methyl-1-[(2S)-pentan-2-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidene-3-nitrosocyclohexan-1-ol |
| SMILES | C=C1[C@H](O)C/C(=C\C=C2/CCC[C@]3(C)C([C@@H](C)CCC)CC[C@@H]23)C[C@H]1N=O |
| InChI | InChI=1S/C24H37NO2/c1-5-7-16(2)20-11-12-21-19(8-6-13-24(20,21)4)10-9-18-14-22(25-27)17(3)23(26)15-18/h9-10,16,20-23,26H,3,5-8,11-15H2,1-2,4H3/b18-9-,19-10+/t16-,20?,21-,22+,23+,24+/m0/s1 |
| InChIKey | QCRDZVUZQQMGTL-FBOYTWMASA-N |
| XLogP | 6.34 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|