C27H42F2O2 — CID 145194531
(5Z)-5-[(2E)-2-[1-(5,5-difluoro-6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol (PubChem CID 145194531) has the molecular formula C27H42F2O2 and a molecular weight of 436.63 g/mol. Its IUPAC name is (5Z)-5-[(2E)-2-[1-(5,5-difluoro-6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol.
| Compound Name | (5Z)-5-[(2E)-2-[1-(5,5-difluoro-6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 145194531 |
| Molecular Formula | C27H42F2O2 |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | (5Z)-5-[(2E)-2-[1-(5,5-difluoro-6-hydroxy-6-methylheptan-2-yl)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC/C(=C/C=C2\CCCC3(C)C2CCC3C(C)CCC(F)(F)C(C)(C)O)CC1O |
| InChI | InChI=1S/C27H42F2O2/c1-18(14-16-27(28,29)25(3,4)31)22-12-13-23-21(7-6-15-26(22,23)5)11-10-20-9-8-19(2)24(30)17-20/h10-11,18,22-24,30-31H,2,6-9,12-17H2,1,3-5H3/b20-10-,21-11+ |
| InChIKey | AGQHTENHTMXEKD-NGHQTVFFSA-N |
| XLogP | 6.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|