C17H30O3 — CID 142407594
(2'R,8'aR)-4'a,8',8'-trimethyl-2'-propan-2-ylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene] (PubChem CID 142407594) has the molecular formula C17H30O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is (2'R,8'aR)-4'a,8',8'-trimethyl-2'-propan-2-ylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene].
| Compound Name | (2'R,8'aR)-4'a,8',8'-trimethyl-2'-propan-2-ylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene] |
|---|---|
| PubChem CID | 142407594 |
| Molecular Formula | C17H30O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.22 |
| IUPAC Name | (2'R,8'aR)-4'a,8',8'-trimethyl-2'-propan-2-ylspiro[1,3-dioxolane-2,7'-2,3,4,5,6,8a-hexahydrochromene] |
| SMILES | CC(C)[C@H]1CCC2(C)CCC3(OCCO3)C(C)(C)[C@@H]2O1 |
| InChI | InChI=1S/C17H30O3/c1-12(2)13-6-7-16(5)8-9-17(18-10-11-19-17)15(3,4)14(16)20-13/h12-14H,6-11H2,1-5H3/t13-,14+,16?/m1/s1 |
| InChIKey | BNVLCOYXAGJNDL-CNYCQXTOSA-N |
| XLogP | 3.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |