C16H23NO2 — CID 153302234
(2R,4aS,8aR)-6-isocyano-4a,8,8-trimethyl-2-propan-2-yl-2,3,4,8a-tetrahydrochromen-7-one (PubChem CID 153302234) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (2R,4aS,8aR)-6-isocyano-4a,8,8-trimethyl-2-propan-2-yl-2,3,4,8a-tetrahydrochromen-7-one.
| Compound Name | (2R,4aS,8aR)-6-isocyano-4a,8,8-trimethyl-2-propan-2-yl-2,3,4,8a-tetrahydrochromen-7-one |
|---|---|
| PubChem CID | 153302234 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (2R,4aS,8aR)-6-isocyano-4a,8,8-trimethyl-2-propan-2-yl-2,3,4,8a-tetrahydrochromen-7-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)CC[C@H](C(C)C)O[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C16H23NO2/c1-10(2)12-7-8-16(5)9-11(17-6)13(18)15(3,4)14(16)19-12/h9-10,12,14H,7-8H2,1-5H3/t12-,14+,16+/m1/s1 |
| InChIKey | HYPHLHXOOJGOSQ-INWMFGNUSA-N |
| XLogP | 3.61 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|