C15H19NO — CID 155617821
(4aS,8aS)-3-isocyano-1,1,4a-trimethyl-6-methylidene-5,7,8,8a-tetrahydronaphthalen-2-one (PubChem CID 155617821) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (4aS,8aS)-3-isocyano-1,1,4a-trimethyl-6-methylidene-5,7,8,8a-tetrahydronaphthalen-2-one.
| Compound Name | (4aS,8aS)-3-isocyano-1,1,4a-trimethyl-6-methylidene-5,7,8,8a-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 155617821 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (4aS,8aS)-3-isocyano-1,1,4a-trimethyl-6-methylidene-5,7,8,8a-tetrahydronaphthalen-2-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)CC(=C)CC[C@@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C15H19NO/c1-10-6-7-12-14(2,3)13(17)11(16-5)9-15(12,4)8-10/h9,12H,1,6-8H2,2-4H3/t12-,15-/m1/s1 |
| InChIKey | NTFIXPDKJIKRSS-IUODEOHRSA-N |
| XLogP | 3.76 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|