C17H23N3O2 — CID 160764250
(5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-1,4,5,5a-tetrahydrobenzo[g]indazole-3,7-dione;tritiomethane (PubChem CID 160764250) has the molecular formula C17H23N3O2 and a molecular weight of 303.40 g/mol. Its IUPAC name is (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-1,4,5,5a-tetrahydrobenzo[g]indazole-3,7-dione;tritiomethane.
| Compound Name | (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-1,4,5,5a-tetrahydrobenzo[g]indazole-3,7-dione;tritiomethane |
|---|---|
| PubChem CID | 160764250 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (5aR,9aR)-8-isocyano-2,6,6,9a-tetramethyl-1,4,5,5a-tetrahydrobenzo[g]indazole-3,7-dione;tritiomethane |
| SMILES | [3H]C.[C-]#[N+]C1=C[C@]2(C)c3[nH]n(C)c(=O)c3CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C16H19N3O2.CH4/c1-15(2)11-7-6-9-12(18-19(5)14(9)21)16(11,3)8-10(17-4)13(15)20;/h8,11,18H,6-7H2,1-3,5H3;1H4/t11-,16-;/m0./s1/i;1T |
| InChIKey | RYMAONQUFIENNO-HQTZBUAZSA-N |
| XLogP | 2.58 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|