C20H23NO4 — CID 59214818
methyl (4aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-8a-carboxylate (PubChem CID 59214818) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl (4aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-8a-carboxylate.
| Compound Name | methyl (4aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 59214818 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl (4aR,10aR)-3-isocyano-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-8a-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)CCC3(C(=O)OC)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C20H23NO4/c1-18(2)14-7-9-20(17(24)25-5)8-6-12(22)10-15(20)19(14,3)11-13(21-4)16(18)23/h10-11,14H,6-9H2,1-3,5H3/t14-,19-,20?/m0/s1 |
| InChIKey | KAXFLVKSLLMQLU-VEUFKTSSSA-N |
| XLogP | 3.26 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|