C32H42FNO3 — CID 163440394
(4aR,6aR,6aS,6bS,8aS,12aR,14bR)-8a-acetyl-6a-fluoro-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-3,13-dione (PubChem CID 163440394) has the molecular formula C32H42FNO3 and a molecular weight of 507.69 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bS,8aS,12aR,14bR)-8a-acetyl-6a-fluoro-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-3,13-dione.
| Compound Name | (4aR,6aR,6aS,6bS,8aS,12aR,14bR)-8a-acetyl-6a-fluoro-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-3,13-dione |
|---|---|
| PubChem CID | 163440394 |
| Molecular Formula | C32H42FNO3 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 507.31 |
| IUPAC Name | (4aR,6aR,6aS,6bS,8aS,12aR,14bR)-8a-acetyl-6a-fluoro-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-5,6,7,8,9,10,12,12a-octahydro-4aH-picene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@]4(F)[C@@H]5CC(C)(C)CC[C@]5(C(C)=O)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H42FNO3/c1-19(35)31-14-12-26(2,3)18-23(31)32(33)24(36)16-22-28(6)17-20(34-9)25(37)27(4,5)21(28)10-11-29(22,7)30(32,8)13-15-31/h16-17,21,23H,10-15,18H2,1-8H3/t21-,23+,28-,29+,30-,31+,32+/m0/s1 |
| InChIKey | KFGRQLXSPUSHDG-DVOPTJCQSA-N |
| XLogP | 7.24 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|