C32H45NO5 — CID 159266665
methyl (4aS,6aS,6bR,8aS,9S,12aR,14aS,14bR)-14a-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,9,14b-decahydropicene-4a-carboxylate;tritiomethane (PubChem CID 159266665) has the molecular formula C32H45NO5 and a molecular weight of 525.72 g/mol. Its IUPAC name is methyl (4aS,6aS,6bR,8aS,9S,12aR,14aS,14bR)-14a-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,9,14b-decahydropicene-4a-carboxylate;tritiomethane.
| Compound Name | methyl (4aS,6aS,6bR,8aS,9S,12aR,14aS,14bR)-14a-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,9,14b-decahydropicene-4a-carboxylate;tritiomethane |
|---|---|
| PubChem CID | 159266665 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 525.34 |
| IUPAC Name | methyl (4aS,6aS,6bR,8aS,9S,12aR,14aS,14bR)-14a-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,9,14b-decahydropicene-4a-carboxylate;tritiomethane |
| SMILES | [3H]C.[C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@]4(O)[C@@H]5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C31H41NO5.CH4/c1-18-19-9-10-28(5)21(27(19,4)16-20(32-7)24(18)34)15-23(33)31(36)22-17-26(2,3)11-13-30(22,25(35)37-8)14-12-29(28,31)6;/h15-16,18-19,22,36H,9-14,17H2,1-6,8H3;1H4/t18-,19-,22+,27-,28+,29-,30-,31+;/m0./s1/i;1T |
| InChIKey | KXEQZWXJIWNFBU-WGQJGUBNSA-N |
| XLogP | 6.09 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|