C30H38N2O3 — CID 88988388
(4S,4aS,6aR,6aS,6bR,8aS,12aS,14bR)-8a-isocyanato-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-4H-picene-3,13-dione (PubChem CID 88988388) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is (4S,4aS,6aR,6aS,6bR,8aS,12aS,14bR)-8a-isocyanato-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-4H-picene-3,13-dione.
| Compound Name | (4S,4aS,6aR,6aS,6bR,8aS,12aS,14bR)-8a-isocyanato-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-4H-picene-3,13-dione |
|---|---|
| PubChem CID | 88988388 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (4S,4aS,6aR,6aS,6bR,8aS,12aS,14bR)-8a-isocyanato-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-4H-picene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(N=C=O)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C30H38N2O3/c1-18-19-8-9-28(5)23(27(19,4)16-21(31-7)25(18)35)14-22(34)24-20-15-26(2,3)10-12-30(20,32-17-33)13-11-29(24,28)6/h14,16,18-20,24H,8-13,15H2,1-6H3/t18-,19-,20-,24-,27-,28+,29+,30-/m0/s1 |
| InChIKey | HUIWBZNVZYBTOY-VXZIHHBCSA-N |
| XLogP | 6.26 |
| TPSA | 67.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|