C31H43N3O3 — CID 166849040
1-[(4aS,6aR,6bS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-3-methylurea (PubChem CID 166849040) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is 1-[(4aS,6aR,6bS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-3-methylurea.
| Compound Name | 1-[(4aS,6aR,6bS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-3-methylurea |
|---|---|
| PubChem CID | 166849040 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | 1-[(4aS,6aR,6bS,9S,12aR)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picen-4a-yl]-3-methylurea |
| SMILES | CNC(=O)N[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)[C@@H](C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C31H43N3O3/c1-18-20-8-9-29(5)23(28(20,4)15-19(17-32)25(18)36)14-22(35)24-21-16-27(2,3)10-12-31(21,34-26(37)33-7)13-11-30(24,29)6/h14-15,18,20-21,24H,8-13,16H2,1-7H3,(H2,33,34,37)/t18-,20?,21?,24?,28-,29+,30+,31-/m0/s1 |
| InChIKey | USCAUPRFVABXEJ-RTTRLJLUSA-N |
| XLogP | 5.50 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |