C32H41F3N2O3 — CID 144797077
(4aS,6aR,6bS,8aS,9S,12aR,14aS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxamide (PubChem CID 144797077) has the molecular formula C32H41F3N2O3 and a molecular weight of 558.69 g/mol. Its IUPAC name is (4aS,6aR,6bS,8aS,9S,12aR,14aS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxamide.
| Compound Name | (4aS,6aR,6bS,8aS,9S,12aR,14aS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxamide |
|---|---|
| PubChem CID | 144797077 |
| Molecular Formula | C32H41F3N2O3 |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | (4aS,6aR,6bS,8aS,9S,12aR,14aS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-N-(2,2,2-trifluoroethyl)-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxamide |
| SMILES | C[C@@H]1C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)[C@H]4C5CC(C)(C)CC[C@]5(C(=O)NCC(F)(F)F)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C32H41F3N2O3/c1-18-20-7-8-29(5)23(28(20,4)14-19(16-36)25(18)39)13-22(38)24-21-15-27(2,3)9-11-31(21,12-10-30(24,29)6)26(40)37-17-32(33,34)35/h13-14,18,20-21,24H,7-12,15,17H2,1-6H3,(H,37,40)/t18-,20-,21?,24+,28-,29+,30+,31-/m0/s1 |
| InChIKey | UUSRHFZIDKYJIV-FOGAIWJDSA-N |
| XLogP | 6.49 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |