C32H39NO4 — CID 138654150
methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-ethynyl-2,2,6a,6b,12a-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 138654150) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-ethynyl-2,2,6a,6b,12a-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-ethynyl-2,2,6a,6b,12a-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 138654150 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-ethynyl-2,2,6a,6b,12a-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | C#C[C@@H]1C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C4C5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C32H39NO4/c1-8-20-21-9-10-30(5)24(29(21,4)16-19(18-33)26(20)35)15-23(34)25-22-17-28(2,3)11-13-32(22,27(36)37-7)14-12-31(25,30)6/h1,15-16,20-22,25H,9-14,17H2,2-7H3/t20-,21-,22?,25?,29-,30+,31+,32-/m0/s1 |
| InChIKey | JIYYVUFNEVOJDY-JDVDOVBSSA-N |
| XLogP | 5.60 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|