C31H41NO4 — CID 126733285
methyl (4aS,6aR,6bS,9R,12aR,14aR,14bS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 126733285) has the molecular formula C31H41NO4 and a molecular weight of 491.67 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,9R,12aR,14aR,14bS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,9R,12aR,14aR,14bS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 126733285 |
| Molecular Formula | C31H41NO4 |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | methyl (4aS,6aR,6bS,9R,12aR,14aR,14bS)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,14a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)[C@H](C)C4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C31H41NO4/c1-18-20-8-9-29(5)23(28(20,4)15-19(17-32)25(18)34)14-22(33)24-21-16-27(2,3)10-12-31(21,26(35)36-7)13-11-30(24,29)6/h14-15,18,20-21,24H,8-13,16H2,1-7H3/t18-,20?,21+,24+,28+,29-,30-,31+/m1/s1 |
| InChIKey | MAOZWESYDBKVCY-CLTZKAPOSA-N |
| XLogP | 5.99 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |