C34H45NO6 — CID 126733315
methyl (4aS,6aR,6bS,8aR,9R,12aS)-9-(acetyloxymethyl)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate (PubChem CID 126733315) has the molecular formula C34H45NO6 and a molecular weight of 563.74 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aR,9R,12aS)-9-(acetyloxymethyl)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aR,9R,12aS)-9-(acetyloxymethyl)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 126733315 |
| Molecular Formula | C34H45NO6 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aR,9R,12aS)-9-(acetyloxymethyl)-11-cyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)[C@@](C)(COC(C)=O)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C34H45NO6/c1-20(36)41-19-31(5)24-9-10-32(6)25(30(24,4)16-21(18-35)27(31)38)15-23(37)26-22-17-29(2,3)11-13-34(22,28(39)40-8)14-12-33(26,32)7/h15-16,22,24,26H,9-14,17,19H2,1-8H3/t22?,24-,26?,30+,31+,32-,33-,34+/m1/s1 |
| InChIKey | PHLBSEHQAPRNLV-GYBQZKARSA-N |
| XLogP | 5.92 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |