C34H47NO6 — CID 59203413
methyl (4aS,6aR,6bS,8aR,9S,12aR,14aR,14bS)-11-isocyano-9-(methoxymethoxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate (PubChem CID 59203413) has the molecular formula C34H47NO6 and a molecular weight of 565.75 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aR,9S,12aR,14aR,14bS)-11-isocyano-9-(methoxymethoxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aR,9S,12aR,14aR,14bS)-11-isocyano-9-(methoxymethoxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 59203413 |
| Molecular Formula | C34H47NO6 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.34 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aR,9S,12aR,14aR,14bS)-11-isocyano-9-(methoxymethoxymethyl)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@@](C)(COCOC)C1=O |
| InChI | InChI=1S/C34H47NO6/c1-29(2)12-14-34(28(38)40-9)15-13-33(6)26(21(34)17-29)23(36)16-25-30(3)18-22(35-7)27(37)31(4,19-41-20-39-8)24(30)10-11-32(25,33)5/h16,18,21,24,26H,10-15,17,19-20H2,1-6,8-9H3/t21-,24+,26-,30-,31+,32+,33+,34-/m0/s1 |
| InChIKey | CBHDSRLLDBIGTL-GHNORBAFSA-N |
| XLogP | 6.33 |
| TPSA | 83.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|