C33H45NO4 — CID 74982043
ethyl 11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate (PubChem CID 74982043) has the molecular formula C33H45NO4 and a molecular weight of 519.73 g/mol. Its IUPAC name is ethyl 11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate.
| Compound Name | ethyl 11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 74982043 |
| Molecular Formula | C33H45NO4 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | ethyl 11-cyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
| SMILES | CCOC(=O)C12CCC(C)(C)CC1C1C(=O)C=C3C4(C)C=C(C#N)C(=O)C(C)(C)C4CCC3(C)C1(C)CC2 |
| InChI | InChI=1S/C33H45NO4/c1-9-38-27(37)33-14-12-28(2,3)18-21(33)25-22(35)16-24-30(6)17-20(19-34)26(36)29(4,5)23(30)10-11-31(24,7)32(25,8)13-15-33/h16-17,21,23,25H,9-15,18H2,1-8H3 |
| InChIKey | LSUFEPKBPIBSRR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |