C31H39NO4 — CID 166848891
methyl (4aS,6aR,6bS,12aS)-11-cyano-2,2,6a,6b,12a-pentamethyl-9-methylidene-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate (PubChem CID 166848891) has the molecular formula C31H39NO4 and a molecular weight of 489.66 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,12aS)-11-cyano-2,2,6a,6b,12a-pentamethyl-9-methylidene-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,12aS)-11-cyano-2,2,6a,6b,12a-pentamethyl-9-methylidene-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
|---|---|
| PubChem CID | 166848891 |
| Molecular Formula | C31H39NO4 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | methyl (4aS,6aR,6bS,12aS)-11-cyano-2,2,6a,6b,12a-pentamethyl-9-methylidene-10,14-dioxo-1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-4a-carboxylate |
| SMILES | C=C1C(=O)C(C#N)=C[C@]2(C)C3=CC(=O)C4C5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CCC12 |
| InChI | InChI=1S/C31H39NO4/c1-18-20-8-9-29(5)23(28(20,4)15-19(17-32)25(18)34)14-22(33)24-21-16-27(2,3)10-12-31(21,26(35)36-7)13-11-30(24,29)6/h14-15,20-21,24H,1,8-13,16H2,2-7H3/t20?,21?,24?,28-,29+,30+,31-/m0/s1 |
| InChIKey | DLHRAMUZXRZKJC-YBLQPQQJSA-N |
| XLogP | 5.91 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|