C33H39NO4 — CID 146506390
methyl (4aS,6aR,6bR,8aR,12aS,14aR,14bS)-11-cyano-6b-ethynyl-2,2,6a,12a-tetramethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-9,1'-cyclopropane]-4a-carboxylate (PubChem CID 146506390) has the molecular formula C33H39NO4 and a molecular weight of 513.68 g/mol. Its IUPAC name is methyl (4aS,6aR,6bR,8aR,12aS,14aR,14bS)-11-cyano-6b-ethynyl-2,2,6a,12a-tetramethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-9,1'-cyclopropane]-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bR,8aR,12aS,14aR,14bS)-11-cyano-6b-ethynyl-2,2,6a,12a-tetramethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-9,1'-cyclopropane]-4a-carboxylate |
|---|---|
| PubChem CID | 146506390 |
| Molecular Formula | C33H39NO4 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | methyl (4aS,6aR,6bR,8aR,12aS,14aR,14bS)-11-cyano-6b-ethynyl-2,2,6a,12a-tetramethyl-10,14-dioxospiro[1,3,4,5,6,7,8,8a,14a,14b-decahydropicene-9,1'-cyclopropane]-4a-carboxylate |
| SMILES | C#C[C@@]12CC[C@H]3C4(CC4)C(=O)C(C#N)=C[C@]3(C)C1=CC(=O)[C@@H]1[C@@H]3CC(C)(C)CC[C@]3(C(=O)OC)CC[C@]12C |
| InChI | InChI=1S/C33H39NO4/c1-7-33-9-8-23-29(4,17-20(19-34)26(36)32(23)14-15-32)24(33)16-22(35)25-21-18-28(2,3)10-12-31(21,27(37)38-6)13-11-30(25,33)5/h1,16-17,21,23,25H,8-15,18H2,2-6H3/t21-,23+,25-,29-,30+,31-,33+/m0/s1 |
| InChIKey | ZPLGTYSECIODKF-JMVROQBKSA-N |
| XLogP | 5.75 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|