C32H42INO4 — CID 176693297
methyl (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate (PubChem CID 176693297) has the molecular formula C32H42INO4 and a molecular weight of 631.60 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 176693297 |
| Molecular Formula | C32H42INO4 |
| Molecular Weight | 631.60 g/mol |
| Exact Mass | 631.22 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aS,12aR,14aR)-11-cyano-8a-iodo-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@]4(I)CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H42INO4/c1-26(2)9-12-31(25(37)38-8)13-10-29(6)23(20(31)17-26)21(35)15-22-28(29,5)11-14-32(33)27(3,4)24(36)19(18-34)16-30(22,32)7/h15-16,20,23H,9-14,17H2,1-8H3/t20?,23-,28+,29+,30+,31-,32+/m0/s1 |
| InChIKey | KCHDMUHUXYKPBR-YEGDRQPUSA-N |
| XLogP | 6.94 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|