C33H44N2O6 — CID 170135950
methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-formyl-8a-(methoxyamino)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate (PubChem CID 170135950) has the molecular formula C33H44N2O6 and a molecular weight of 564.72 g/mol. Its IUPAC name is methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-formyl-8a-(methoxyamino)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-formyl-8a-(methoxyamino)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 170135950 |
| Molecular Formula | C33H44N2O6 |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | methyl (4aS,6aR,6bS,8aS,9R,12aR)-11-cyano-9-formyl-8a-(methoxyamino)-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,5,6,7,8,14a,14b-octahydro-1H-picene-4a-carboxylate |
| SMILES | CON[C@@]12CC[C@]3(C)C(=CC(=O)C4C5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@]43C)[C@@]1(C)C=C(C#N)C(=O)[C@@]2(C)C=O |
| InChI | InChI=1S/C33H44N2O6/c1-27(2)9-12-32(26(39)40-7)13-10-29(4)24(21(32)17-27)22(37)15-23-28(29,3)11-14-33(35-41-8)30(23,5)16-20(18-34)25(38)31(33,6)19-36/h15-16,19,21,24,35H,9-14,17H2,1-8H3/t21?,24?,28-,29-,30-,31-,32+,33+/m1/s1 |
| InChIKey | OIFRUBQDOJSHIA-GKUZKAMOSA-N |
| XLogP | 4.83 |
| TPSA | 122.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|