C32H42N2O3 — CID 146262323
(1S,2R,5S,15S,21S)-17-cyano-N,1,2,8,8,15,19-heptamethyl-12,18-dioxohexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricosa-13,16-diene-5-carboxamide (PubChem CID 146262323) has the molecular formula C32H42N2O3 and a molecular weight of 502.70 g/mol. Its IUPAC name is (1S,2R,5S,15S,21S)-17-cyano-N,1,2,8,8,15,19-heptamethyl-12,18-dioxohexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricosa-13,16-diene-5-carboxamide.
| Compound Name | (1S,2R,5S,15S,21S)-17-cyano-N,1,2,8,8,15,19-heptamethyl-12,18-dioxohexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricosa-13,16-diene-5-carboxamide |
|---|---|
| PubChem CID | 146262323 |
| Molecular Formula | C32H42N2O3 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.32 |
| IUPAC Name | (1S,2R,5S,15S,21S)-17-cyano-N,1,2,8,8,15,19-heptamethyl-12,18-dioxohexacyclo[12.9.0.02,11.05,10.015,21.019,21]tricosa-13,16-diene-5-carboxamide |
| SMILES | CNC(=O)[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C5(C)C[C@]54CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H42N2O3/c1-26(2)8-11-31(25(37)34-7)12-9-28(4)23(20(31)16-26)21(35)14-22-27(28,3)10-13-32-18-30(32,6)24(36)19(17-33)15-29(22,32)5/h14-15,20,23H,8-13,16,18H2,1-7H3,(H,34,37)/t20?,23?,27-,28-,29-,30?,31+,32+/m1/s1 |
| InChIKey | AHEZMLFDZXLZRJ-PWIPLEFUSA-N |
| XLogP | 5.71 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |