C35H45N3O3 — CID 10053415
(4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylimidazole-1-carbonyl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 10053415) has the molecular formula C35H45N3O3 and a molecular weight of 555.76 g/mol. Its IUPAC name is (4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylimidazole-1-carbonyl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | (4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylimidazole-1-carbonyl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 10053415 |
| Molecular Formula | C35H45N3O3 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | (4aR,6aS,6bR,8aS,14bS)-4,4,6a,6b,11,11,14b-heptamethyl-8a-(2-methylimidazole-1-carbonyl)-3,13-dioxo-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | Cc1nccn1C(=O)[C@]12CCC(C)(C)CC1C1C(=O)C=C3[C@@]4(C)C=C(C#N)C(=O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C35H45N3O3/c1-21-37-15-16-38(21)29(41)35-13-11-30(2,3)19-23(35)27-24(39)17-26-32(6)18-22(20-36)28(40)31(4,5)25(32)9-10-33(26,7)34(27,8)12-14-35/h15-18,23,25,27H,9-14,19H2,1-8H3/t23?,25-,27?,32-,33+,34+,35-/m0/s1 |
| InChIKey | RBBYCTUCARICCN-SYNRXBCDSA-N |
| XLogP | 7.05 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |